C24H22BrN3O2 — CID 3129952
N-(2-bromophenyl)-3-[(2,2-diphenylacetyl)hydrazinylidene]butanamide (PubChem CID 3129952) has the molecular formula C24H22BrN3O2 and a molecular weight of 464.36 g/mol. Its IUPAC name is N-(2-bromophenyl)-3-[(2,2-diphenylacetyl)hydrazinylidene]butanamide.
| Compound Name | N-(2-bromophenyl)-3-[(2,2-diphenylacetyl)hydrazinylidene]butanamide |
|---|---|
| PubChem CID | 3129952 |
| Molecular Formula | C24H22BrN3O2 |
| Molecular Weight | 464.36 g/mol |
| Exact Mass | 463.09 |
| IUPAC Name | N-(2-bromophenyl)-3-[(2,2-diphenylacetyl)hydrazinylidene]butanamide |
| SMILES | CC(CC(=O)Nc1ccccc1Br)=NNC(=O)C(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H22BrN3O2/c1-17(16-22(29)26-21-15-9-8-14-20(21)25)27-28-24(30)23(18-10-4-2-5-11-18)19-12-6-3-7-13-19/h2-15,23H,16H2,1H3,(H,26,29)(H,28,30) |
| InChIKey | NHTWZIAZXCYZIV-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 70.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 464.36 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|