C23H26N4O3S — CID 31315172
N-[5-[[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 31315172) has the molecular formula C23H26N4O3S and a molecular weight of 438.55 g/mol. Its IUPAC name is N-[5-[[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 31315172 |
| Molecular Formula | C23H26N4O3S |
| Molecular Weight | 438.55 g/mol |
| Exact Mass | 438.17 |
| IUPAC Name | N-[5-[[4-(4-ethylpiperazin-1-yl)-3-methylphenyl]carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | CCN1CCN(c2ccc(NC(=O)c3ccc(NC(=O)c4ccco4)s3)cc2C)CC1 |
| InChI | InChI=1S/C23H26N4O3S/c1-3-26-10-12-27(13-11-26)18-7-6-17(15-16(18)2)24-23(29)20-8-9-21(31-20)25-22(28)19-5-4-14-30-19/h4-9,14-15H,3,10-13H2,1-2H3,(H,24,29)(H,25,28) |
| InChIKey | YWQIZRTXOAXIPQ-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.55 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'} |
|---|