C19H16N2O4S — CID 86835443
N-[5-[(3-prop-2-enoxyphenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide (PubChem CID 86835443) has the molecular formula C19H16N2O4S and a molecular weight of 368.41 g/mol. Its IUPAC name is N-[5-[(3-prop-2-enoxyphenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide.
| Compound Name | N-[5-[(3-prop-2-enoxyphenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide |
|---|---|
| PubChem CID | 86835443 |
| Molecular Formula | C19H16N2O4S |
| Molecular Weight | 368.41 g/mol |
| Exact Mass | 368.08 |
| IUPAC Name | N-[5-[(3-prop-2-enoxyphenyl)carbamoyl]thiophen-2-yl]furan-2-carboxamide |
| SMILES | C=CCOc1cccc(NC(=O)c2ccc(NC(=O)c3ccco3)s2)c1 |
| InChI | InChI=1S/C19H16N2O4S/c1-2-10-24-14-6-3-5-13(12-14)20-19(23)16-8-9-17(26-16)21-18(22)15-7-4-11-25-15/h2-9,11-12H,1,10H2,(H,20,23)(H,21,22) |
| InChIKey | XMBAGWFIVNFDTN-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 80.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.41 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|