C16H22N2O3 — CID 3131606
tert-butyl 5-hydroxy-3-methyl-5-(4-methylphenyl)-4H-pyrazole-1-carboxylate (PubChem CID 3131606) has the molecular formula C16H22N2O3 and a molecular weight of 290.36 g/mol. Its IUPAC name is tert-butyl 5-hydroxy-3-methyl-5-(4-methylphenyl)-4H-pyrazole-1-carboxylate.
| Compound Name | tert-butyl 5-hydroxy-3-methyl-5-(4-methylphenyl)-4H-pyrazole-1-carboxylate |
|---|---|
| PubChem CID | 3131606 |
| Molecular Formula | C16H22N2O3 |
| Molecular Weight | 290.36 g/mol |
| Exact Mass | 290.16 |
| IUPAC Name | tert-butyl 5-hydroxy-3-methyl-5-(4-methylphenyl)-4H-pyrazole-1-carboxylate |
| SMILES | CC1=NN(C(=O)OC(C)(C)C)C(O)(c2ccc(C)cc2)C1 |
| InChI | InChI=1S/C16H22N2O3/c1-11-6-8-13(9-7-11)16(20)10-12(2)17-18(16)14(19)21-15(3,4)5/h6-9,20H,10H2,1-5H3 |
| InChIKey | XZXKFSJGLQYDGY-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 62.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.36 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |