About [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate
[2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate (PubChem CID 31390918) has the molecular formula C16H8BrF3O5S
and a molecular weight of 449.20 g/mol. Its IUPAC name is [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate.
Molecular Properties
| Compound Name | [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate |
| PubChem CID | 31390918 |
| Molecular Formula | C16H8BrF3O5S |
| Molecular Weight | 449.20 g/mol |
| Exact Mass | 447.92 |
| IUPAC Name | [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate |
| SMILES | O=c1cc(C(F)(F)F)c2ccc(OS(=O)(=O)c3ccccc3Br)cc2o1 |
| InChI | InChI=1S/C16H8BrF3O5S/c17-12-3-1-2-4-14(12)26(22,23)25-9-5-6-10-11(16(18,19)20)8-15(21)24-13(10)7-9/h1-8H |
| InChIKey | MADVZROKOCFYSS-UHFFFAOYSA-N |
| XLogP | 4.34 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 449.20 |
| LogP ≤ 5 | 4.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate?
The IUPAC name of [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate (CID 31390918) is [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate.
What is the SMILES notation for [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate?
The canonical SMILES for [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate is O=c1cc(C(F)(F)F)c2ccc(OS(=O)(=O)c3ccccc3Br)cc2o1.
What is the InChIKey of [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate?
The InChIKey is MADVZROKOCFYSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H8BrF3O5S/c17-12-3-1-2-4-14(12)26(22,23)25-9-5-6-10-11(16(18,19)20)8-15(21)24-13(10)7-9/h1-8H.
What are the key properties of [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate?
[2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate has a molecular weight of 449.20 g/mol, XLogP of 4.34, 3 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [2-oxo-4-(trifluoromethyl)chromen-7-yl] 2-bromobenzenesulfonate is sourced from PubChem (CID 31390918), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).