C16H17F3O5S — CID 100674586
[2-oxo-4-(trifluoromethyl)chromen-7-yl] (3S)-hexane-3-sulfonate (PubChem CID 100674586) has the molecular formula C16H17F3O5S and a molecular weight of 378.37 g/mol. Its IUPAC name is [2-oxo-4-(trifluoromethyl)chromen-7-yl] (3S)-hexane-3-sulfonate.
| Compound Name | [2-oxo-4-(trifluoromethyl)chromen-7-yl] (3S)-hexane-3-sulfonate |
|---|---|
| PubChem CID | 100674586 |
| Molecular Formula | C16H17F3O5S |
| Molecular Weight | 378.37 g/mol |
| Exact Mass | 378.07 |
| IUPAC Name | [2-oxo-4-(trifluoromethyl)chromen-7-yl] (3S)-hexane-3-sulfonate |
| SMILES | CCC[C@H](CC)S(=O)(=O)Oc1ccc2c(C(F)(F)F)cc(=O)oc2c1 |
| InChI | InChI=1S/C16H17F3O5S/c1-3-5-11(4-2)25(21,22)24-10-6-7-12-13(16(17,18)19)9-15(20)23-14(12)8-10/h6-9,11H,3-5H2,1-2H3/t11-/m0/s1 |
| InChIKey | NKMDATHRHZVTGT-NSHDSACASA-N |
| XLogP | 4.10 |
| TPSA | 73.58 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.37 |
| LogP ≤ 5 | 4.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'cumarine', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|