C16H20N2O5S — CID 31391604
N-[4-methoxy-3-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phenyl]acetamide (PubChem CID 31391604) has the molecular formula C16H20N2O5S and a molecular weight of 352.41 g/mol. Its IUPAC name is N-[4-methoxy-3-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phenyl]acetamide.
| Compound Name | N-[4-methoxy-3-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phenyl]acetamide |
|---|---|
| PubChem CID | 31391604 |
| Molecular Formula | C16H20N2O5S |
| Molecular Weight | 352.41 g/mol |
| Exact Mass | 352.11 |
| IUPAC Name | N-[4-methoxy-3-[methyl-[(5-methylfuran-2-yl)methyl]sulfamoyl]phenyl]acetamide |
| SMILES | COc1ccc(NC(C)=O)cc1S(=O)(=O)N(C)Cc1ccc(C)o1 |
| InChI | InChI=1S/C16H20N2O5S/c1-11-5-7-14(23-11)10-18(3)24(20,21)16-9-13(17-12(2)19)6-8-15(16)22-4/h5-9H,10H2,1-4H3,(H,17,19) |
| InChIKey | QWKMOFODFBHXAU-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 88.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.41 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |