C20H22FN3O3 — CID 3139426
N'-[(3-fluorophenyl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide (PubChem CID 3139426) has the molecular formula C20H22FN3O3 and a molecular weight of 371.41 g/mol. Its IUPAC name is N'-[(3-fluorophenyl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide.
| Compound Name | N'-[(3-fluorophenyl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide |
|---|---|
| PubChem CID | 3139426 |
| Molecular Formula | C20H22FN3O3 |
| Molecular Weight | 371.41 g/mol |
| Exact Mass | 371.16 |
| IUPAC Name | N'-[(3-fluorophenyl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide |
| SMILES | CC(C)(Cc1ccc(O)cc1)NC(=O)CC(=O)NN=Cc1cccc(F)c1 |
| InChI | InChI=1S/C20H22FN3O3/c1-20(2,12-14-6-8-17(25)9-7-14)23-18(26)11-19(27)24-22-13-15-4-3-5-16(21)10-15/h3-10,13,25H,11-12H2,1-2H3,(H,23,26)(H,24,27) |
| InChIKey | QZKLOWNJJPYWHL-UHFFFAOYSA-N |
| XLogP | 2.51 |
| TPSA | 90.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.41 |
| LogP ≤ 5 | 2.51 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|