C20H22N4O5 — CID 5348708
N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]-N'-[(E)-(4-nitrophenyl)methylideneamino]propanediamide (PubChem CID 5348708) has the molecular formula C20H22N4O5 and a molecular weight of 398.42 g/mol. Its IUPAC name is N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]-N'-[(E)-(4-nitrophenyl)methylideneamino]propanediamide.
| Compound Name | N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]-N'-[(E)-(4-nitrophenyl)methylideneamino]propanediamide |
|---|---|
| PubChem CID | 5348708 |
| Molecular Formula | C20H22N4O5 |
| Molecular Weight | 398.42 g/mol |
| Exact Mass | 398.16 |
| IUPAC Name | N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]-N'-[(E)-(4-nitrophenyl)methylideneamino]propanediamide |
| SMILES | CC(C)(Cc1ccc(O)cc1)NC(=O)CC(=O)N/N=C/c1ccc([N+](=O)[O-])cc1 |
| InChI | InChI=1S/C20H22N4O5/c1-20(2,12-14-5-9-17(25)10-6-14)22-18(26)11-19(27)23-21-13-15-3-7-16(8-4-15)24(28)29/h3-10,13,25H,11-12H2,1-2H3,(H,22,26)(H,23,27)/b21-13+ |
| InChIKey | VUTPWSJNUPTWKG-FYJGNVAPSA-N |
| XLogP | 2.28 |
| TPSA | 133.93 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.42 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|