C24H25N3O4 — CID 136769030
N'-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide (PubChem CID 136769030) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is N'-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide.
| Compound Name | N'-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide |
|---|---|
| PubChem CID | 136769030 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | N'-[(Z)-(2-hydroxynaphthalen-1-yl)methylideneamino]-N-[1-(4-hydroxyphenyl)-2-methylpropan-2-yl]propanediamide |
| SMILES | CC(C)(Cc1ccc(O)cc1)NC(=O)CC(=O)N/N=C\c1c(O)ccc2ccccc12 |
| InChI | InChI=1S/C24H25N3O4/c1-24(2,14-16-7-10-18(28)11-8-16)26-22(30)13-23(31)27-25-15-20-19-6-4-3-5-17(19)9-12-21(20)29/h3-12,15,28-29H,13-14H2,1-2H3,(H,26,30)(H,27,31)/b25-15- |
| InChIKey | QBRUELPZHSRKAX-MYYYXRDXSA-N |
| XLogP | 3.23 |
| TPSA | 111.02 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|