C23H38N2O9 — CID 3148002
4-methyl-2-[[3-methyl-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]butanoyl]amino]pentanoic acid (PubChem CID 3148002) has the molecular formula C23H38N2O9 and a molecular weight of 486.56 g/mol. Its IUPAC name is 4-methyl-2-[[3-methyl-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]butanoyl]amino]pentanoic acid.
| Compound Name | 4-methyl-2-[[3-methyl-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]butanoyl]amino]pentanoic acid |
|---|---|
| PubChem CID | 3148002 |
| Molecular Formula | C23H38N2O9 |
| Molecular Weight | 486.56 g/mol |
| Exact Mass | 486.26 |
| IUPAC Name | 4-methyl-2-[[3-methyl-2-[(4,4,11,11-tetramethyl-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carbonyl)amino]butanoyl]amino]pentanoic acid |
| SMILES | CC(C)CC(NC(=O)C(NC(=O)C1OC2OC(C)(C)OC2C2OC(C)(C)OC12)C(C)C)C(=O)O |
| InChI | InChI=1S/C23H38N2O9/c1-10(2)9-12(20(28)29)24-18(26)13(11(3)4)25-19(27)16-14-15(32-22(5,6)31-14)17-21(30-16)34-23(7,8)33-17/h10-17,21H,9H2,1-8H3,(H,24,26)(H,25,27)(H,28,29) |
| InChIKey | ZZHGKGQIPZGFLE-UHFFFAOYSA-N |
| XLogP | 1.14 |
| TPSA | 141.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.56 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |