C27H34N2O7 — CID 3523922
4,4,11,11-tetramethyl-N-[3-methyl-1-(naphthalen-1-ylamino)-1-oxobutan-2-yl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide (PubChem CID 3523922) has the molecular formula C27H34N2O7 and a molecular weight of 498.58 g/mol. Its IUPAC name is 4,4,11,11-tetramethyl-N-[3-methyl-1-(naphthalen-1-ylamino)-1-oxobutan-2-yl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide.
| Compound Name | 4,4,11,11-tetramethyl-N-[3-methyl-1-(naphthalen-1-ylamino)-1-oxobutan-2-yl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
|---|---|
| PubChem CID | 3523922 |
| Molecular Formula | C27H34N2O7 |
| Molecular Weight | 498.58 g/mol |
| Exact Mass | 498.24 |
| IUPAC Name | 4,4,11,11-tetramethyl-N-[3-methyl-1-(naphthalen-1-ylamino)-1-oxobutan-2-yl]-3,5,7,10,12-pentaoxatricyclo[7.3.0.02,6]dodecane-8-carboxamide |
| SMILES | CC(C)C(NC(=O)C1OC2OC(C)(C)OC2C2OC(C)(C)OC12)C(=O)Nc1cccc2ccccc12 |
| InChI | InChI=1S/C27H34N2O7/c1-14(2)18(23(30)28-17-13-9-11-15-10-7-8-12-16(15)17)29-24(31)21-19-20(34-26(3,4)33-19)22-25(32-21)36-27(5,6)35-22/h7-14,18-22,25H,1-6H3,(H,28,30)(H,29,31) |
| InChIKey | WOZSVUPWCKJOCB-UHFFFAOYSA-N |
| XLogP | 3.32 |
| TPSA | 104.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.58 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |