C20H16N4O5S2 — CID 31515987
N-[3-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]phenyl]thiophene-2-carboxamide (PubChem CID 31515987) has the molecular formula C20H16N4O5S2 and a molecular weight of 456.51 g/mol. Its IUPAC name is N-[3-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]phenyl]thiophene-2-carboxamide.
| Compound Name | N-[3-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]phenyl]thiophene-2-carboxamide |
|---|---|
| PubChem CID | 31515987 |
| Molecular Formula | C20H16N4O5S2 |
| Molecular Weight | 456.51 g/mol |
| Exact Mass | 456.06 |
| IUPAC Name | N-[3-[[2-(4-carbamoyl-2-nitrophenyl)sulfanylacetyl]amino]phenyl]thiophene-2-carboxamide |
| SMILES | NC(=O)c1ccc(SCC(=O)Nc2cccc(NC(=O)c3cccs3)c2)c([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H16N4O5S2/c21-19(26)12-6-7-16(15(9-12)24(28)29)31-11-18(25)22-13-3-1-4-14(10-13)23-20(27)17-5-2-8-30-17/h1-10H,11H2,(H2,21,26)(H,22,25)(H,23,27) |
| InChIKey | KNRGHOGFKZDLDH-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 144.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 456.51 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|