About 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone
1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone (PubChem CID 31520092) has the molecular formula C16H23N5OS
and a molecular weight of 333.46 g/mol. Its IUPAC name is 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone.
Molecular Properties
| Compound Name | 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone |
| PubChem CID | 31520092 |
| Molecular Formula | C16H23N5OS |
| Molecular Weight | 333.46 g/mol |
| Exact Mass | 333.16 |
| IUPAC Name | 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone |
| SMILES | CC(=O)N1CCN([C@@H](C)c2nc(N)c3c(C)c(C)sc3n2)CC1 |
| InChI | InChI=1S/C16H23N5OS/c1-9-11(3)23-16-13(9)14(17)18-15(19-16)10(2)20-5-7-21(8-6-20)12(4)22/h10H,5-8H2,1-4H3,(H2,17,18,19)/t10-/m0/s1 |
| InChIKey | ILPYELLBVQDBQY-JTQLQIEISA-N |
| XLogP | 2.12 |
| TPSA | 75.35 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.46 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone?
The IUPAC name of 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone (CID 31520092) is 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone.
What is the SMILES notation for 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone?
The canonical SMILES for 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone is CC(=O)N1CCN([C@@H](C)c2nc(N)c3c(C)c(C)sc3n2)CC1.
What is the InChIKey of 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone?
The InChIKey is ILPYELLBVQDBQY-JTQLQIEISA-N. The full InChI is InChI=1S/C16H23N5OS/c1-9-11(3)23-16-13(9)14(17)18-15(19-16)10(2)20-5-7-21(8-6-20)12(4)22/h10H,5-8H2,1-4H3,(H2,17,18,19)/t10-/m0/s1.
What are the key properties of 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone?
1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone has a molecular weight of 333.46 g/mol, XLogP of 2.12, 2 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[4-[(1S)-1-(4-amino-5,6-dimethylthieno[2,3-d]pyrimidin-2-yl)ethyl]piperazin-1-yl]ethanone is sourced from PubChem (CID 31520092), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).