C19H19ClO5 — CID 31524530
methyl 2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]oxymethyl]furan-3-carboxylate (PubChem CID 31524530) has the molecular formula C19H19ClO5 and a molecular weight of 362.81 g/mol. Its IUPAC name is methyl 2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]oxymethyl]furan-3-carboxylate.
| Compound Name | methyl 2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]oxymethyl]furan-3-carboxylate |
|---|---|
| PubChem CID | 31524530 |
| Molecular Formula | C19H19ClO5 |
| Molecular Weight | 362.81 g/mol |
| Exact Mass | 362.09 |
| IUPAC Name | methyl 2-[[1-(4-chlorophenyl)cyclopentanecarbonyl]oxymethyl]furan-3-carboxylate |
| SMILES | COC(=O)c1ccoc1COC(=O)C1(c2ccc(Cl)cc2)CCCC1 |
| InChI | InChI=1S/C19H19ClO5/c1-23-17(21)15-8-11-24-16(15)12-25-18(22)19(9-2-3-10-19)13-4-6-14(20)7-5-13/h4-8,11H,2-3,9-10,12H2,1H3 |
| InChIKey | COXUZYFKVMDLPE-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 65.74 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.81 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |