C13H15N3OS — CID 3156766
4-methyl-6-(2-phenoxyethylsulfanyl)pyrimidin-2-amine (PubChem CID 3156766) has the molecular formula C13H15N3OS and a molecular weight of 261.35 g/mol. Its IUPAC name is 4-methyl-6-(2-phenoxyethylsulfanyl)pyrimidin-2-amine.
| Compound Name | 4-methyl-6-(2-phenoxyethylsulfanyl)pyrimidin-2-amine |
|---|---|
| PubChem CID | 3156766 |
| Molecular Formula | C13H15N3OS |
| Molecular Weight | 261.35 g/mol |
| Exact Mass | 261.09 |
| IUPAC Name | 4-methyl-6-(2-phenoxyethylsulfanyl)pyrimidin-2-amine |
| SMILES | Cc1cc(SCCOc2ccccc2)nc(N)n1 |
| InChI | InChI=1S/C13H15N3OS/c1-10-9-12(16-13(14)15-10)18-8-7-17-11-5-3-2-4-6-11/h2-6,9H,7-8H2,1H3,(H2,14,15,16) |
| InChIKey | OHGSDOXXCABCOI-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 61.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 261.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|