C15H11BrF4N2O3S — CID 31579011
4-[(4-bromo-2-fluorophenyl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide (PubChem CID 31579011) has the molecular formula C15H11BrF4N2O3S and a molecular weight of 455.23 g/mol. Its IUPAC name is 4-[(4-bromo-2-fluorophenyl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide.
| Compound Name | 4-[(4-bromo-2-fluorophenyl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
|---|---|
| PubChem CID | 31579011 |
| Molecular Formula | C15H11BrF4N2O3S |
| Molecular Weight | 455.23 g/mol |
| Exact Mass | 453.96 |
| IUPAC Name | 4-[(4-bromo-2-fluorophenyl)sulfamoyl]-N-(2,2,2-trifluoroethyl)benzamide |
| SMILES | O=C(NCC(F)(F)F)c1ccc(S(=O)(=O)Nc2ccc(Br)cc2F)cc1 |
| InChI | InChI=1S/C15H11BrF4N2O3S/c16-10-3-6-13(12(17)7-10)22-26(24,25)11-4-1-9(2-5-11)14(23)21-8-15(18,19)20/h1-7,22H,8H2,(H,21,23) |
| InChIKey | UTJUJSBULIYEGF-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 455.23 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |