C10H16N2 — CID 3158584
N',N'-dimethyl-1-phenylethane-1,2-diamine (PubChem CID 3158584) has the molecular formula C10H16N2 and a molecular weight of 164.25 g/mol. Its IUPAC name is N',N'-dimethyl-1-phenylethane-1,2-diamine.
| Compound Name | N',N'-dimethyl-1-phenylethane-1,2-diamine |
|---|---|
| PubChem CID | 3158584 |
| Molecular Formula | C10H16N2 |
| Molecular Weight | 164.25 g/mol |
| Exact Mass | 164.13 |
| IUPAC Name | N',N'-dimethyl-1-phenylethane-1,2-diamine |
| SMILES | CN(C)CC(N)c1ccccc1 |
| InChI | InChI=1S/C10H16N2/c1-12(2)8-10(11)9-6-4-3-5-7-9/h3-7,10H,8,11H2,1-2H3 |
| InChIKey | NPGAXSHDDOESHB-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |