C15H10F3IN4OS — CID 31610582
N-(2-iodophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide (PubChem CID 31610582) has the molecular formula C15H10F3IN4OS and a molecular weight of 478.24 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide.
| Compound Name | N-(2-iodophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 31610582 |
| Molecular Formula | C15H10F3IN4OS |
| Molecular Weight | 478.24 g/mol |
| Exact Mass | 477.96 |
| IUPAC Name | N-(2-iodophenyl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc2ccc(C(F)(F)F)cn12)Nc1ccccc1I |
| InChI | InChI=1S/C15H10F3IN4OS/c16-15(17,18)9-5-6-12-21-22-14(23(12)7-9)25-8-13(24)20-11-4-2-1-3-10(11)19/h1-7H,8H2,(H,20,24) |
| InChIKey | LXGYRWYGIAWEPN-UHFFFAOYSA-N |
| XLogP | 4.08 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.24 |
| LogP ≤ 5 | 4.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|