C12H12F3N5O2S — CID 47091870
N-carbamoyl-4-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]butanamide (PubChem CID 47091870) has the molecular formula C12H12F3N5O2S and a molecular weight of 347.32 g/mol. Its IUPAC name is N-carbamoyl-4-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]butanamide.
| Compound Name | N-carbamoyl-4-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]butanamide |
|---|---|
| PubChem CID | 47091870 |
| Molecular Formula | C12H12F3N5O2S |
| Molecular Weight | 347.32 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | N-carbamoyl-4-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]butanamide |
| SMILES | NC(=O)NC(=O)CCCSc1nnc2ccc(C(F)(F)F)cn12 |
| InChI | InChI=1S/C12H12F3N5O2S/c13-12(14,15)7-3-4-8-18-19-11(20(8)6-7)23-5-1-2-9(21)17-10(16)22/h3-4,6H,1-2,5H2,(H3,16,17,21,22) |
| InChIKey | CNWXTWQYHIELCU-UHFFFAOYSA-N |
| XLogP | 1.82 |
| TPSA | 102.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.32 |
| LogP ≤ 5 | 1.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|