C19H19F3N4O3S — CID 31613632
N-[2-(4-ethoxyphenoxy)ethyl]-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide (PubChem CID 31613632) has the molecular formula C19H19F3N4O3S and a molecular weight of 440.45 g/mol. Its IUPAC name is N-[2-(4-ethoxyphenoxy)ethyl]-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide.
| Compound Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 31613632 |
| Molecular Formula | C19H19F3N4O3S |
| Molecular Weight | 440.45 g/mol |
| Exact Mass | 440.11 |
| IUPAC Name | N-[2-(4-ethoxyphenoxy)ethyl]-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide |
| SMILES | CCOc1ccc(OCCNC(=O)CSc2nnc3ccc(C(F)(F)F)cn23)cc1 |
| InChI | InChI=1S/C19H19F3N4O3S/c1-2-28-14-4-6-15(7-5-14)29-10-9-23-17(27)12-30-18-25-24-16-8-3-13(11-26(16)18)19(20,21)22/h3-8,11H,2,9-10,12H2,1H3,(H,23,27) |
| InChIKey | AFOGODWPRHYDME-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 77.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.45 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|