C19H17F3N4OS — CID 46513847
N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide (PubChem CID 46513847) has the molecular formula C19H17F3N4OS and a molecular weight of 406.43 g/mol. Its IUPAC name is N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide.
| Compound Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide |
|---|---|
| PubChem CID | 46513847 |
| Molecular Formula | C19H17F3N4OS |
| Molecular Weight | 406.43 g/mol |
| Exact Mass | 406.11 |
| IUPAC Name | N-(1,2,3,4-tetrahydronaphthalen-1-yl)-2-[[6-(trifluoromethyl)-[1,2,4]triazolo[4,3-a]pyridin-3-yl]sulfanyl]acetamide |
| SMILES | O=C(CSc1nnc2ccc(C(F)(F)F)cn12)NC1CCCc2ccccc21 |
| InChI | InChI=1S/C19H17F3N4OS/c20-19(21,22)13-8-9-16-24-25-18(26(16)10-13)28-11-17(27)23-15-7-3-5-12-4-1-2-6-14(12)15/h1-2,4,6,8-10,15H,3,5,7,11H2,(H,23,27) |
| InChIKey | IIBUBMAUFDIWMY-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 59.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 406.43 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |