C24H27N3O2 — CID 3161594
4-[1-[2-(2,3-dimethylphenoxy)ethyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one (PubChem CID 3161594) has the molecular formula C24H27N3O2 and a molecular weight of 389.50 g/mol. Its IUPAC name is 4-[1-[2-(2,3-dimethylphenoxy)ethyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one.
| Compound Name | 4-[1-[2-(2,3-dimethylphenoxy)ethyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one |
|---|---|
| PubChem CID | 3161594 |
| Molecular Formula | C24H27N3O2 |
| Molecular Weight | 389.50 g/mol |
| Exact Mass | 389.21 |
| IUPAC Name | 4-[1-[2-(2,3-dimethylphenoxy)ethyl]benzimidazol-2-yl]-1-prop-2-enylpyrrolidin-2-one |
| SMILES | C=CCN1CC(c2nc3ccccc3n2CCOc2cccc(C)c2C)CC1=O |
| InChI | InChI=1S/C24H27N3O2/c1-4-12-26-16-19(15-23(26)28)24-25-20-9-5-6-10-21(20)27(24)13-14-29-22-11-7-8-17(2)18(22)3/h4-11,19H,1,12-16H2,2-3H3 |
| InChIKey | GDFAIHHFBCMZHL-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 47.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.50 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|