C10H11N5O2 — CID 3162667
2,4,7-trimethyl-6H-purino[7,8-a]imidazole-1,3-dione (PubChem CID 3162667) has the molecular formula C10H11N5O2 and a molecular weight of 233.23 g/mol. Its IUPAC name is 2,4,7-trimethyl-6H-purino[7,8-a]imidazole-1,3-dione.
| Compound Name | 2,4,7-trimethyl-6H-purino[7,8-a]imidazole-1,3-dione |
|---|---|
| PubChem CID | 3162667 |
| Molecular Formula | C10H11N5O2 |
| Molecular Weight | 233.23 g/mol |
| Exact Mass | 233.09 |
| IUPAC Name | 2,4,7-trimethyl-6H-purino[7,8-a]imidazole-1,3-dione |
| SMILES | Cc1cn2c(nc3c2c(=O)n(C)c(=O)n3C)[nH]1 |
| InChI | InChI=1S/C10H11N5O2/c1-5-4-15-6-7(12-9(15)11-5)13(2)10(17)14(3)8(6)16/h4H,1-3H3,(H,11,12) |
| InChIKey | UCRWKJWWUYKFAC-UHFFFAOYSA-N |
| XLogP | -0.48 |
| TPSA | 77.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.23 |
| LogP ≤ 5 | -0.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |