C15H17N7O — CID 10543051
(11R,15S)-4-(1H-imidazol-2-ylmethyl)-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one (PubChem CID 10543051) has the molecular formula C15H17N7O and a molecular weight of 311.35 g/mol. Its IUPAC name is (11R,15S)-4-(1H-imidazol-2-ylmethyl)-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one.
| Compound Name | (11R,15S)-4-(1H-imidazol-2-ylmethyl)-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
|---|---|
| PubChem CID | 10543051 |
| Molecular Formula | C15H17N7O |
| Molecular Weight | 311.35 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | (11R,15S)-4-(1H-imidazol-2-ylmethyl)-8-methyl-1,3,5,8,10-pentazatetracyclo[7.6.0.02,6.011,15]pentadeca-2(6),3,9-trien-7-one |
| SMILES | CN1C(=O)c2[nH]c(Cc3ncc[nH]3)nc2N2C1=N[C@@H]1CCC[C@@H]12 |
| InChI | InChI=1S/C15H17N7O/c1-21-14(23)12-13(20-11(19-12)7-10-16-5-6-17-10)22-9-4-2-3-8(9)18-15(21)22/h5-6,8-9H,2-4,7H2,1H3,(H,16,17)(H,19,20)/t8-,9+/m1/s1 |
| InChIKey | KMYOXGWXJSPRMG-BDAKNGLRSA-N |
| XLogP | 0.91 |
| TPSA | 93.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.35 |
| LogP ≤ 5 | 0.91 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |