C18H14N4O2S — CID 3163224
6-(4-methoxyphenyl)-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine (PubChem CID 3163224) has the molecular formula C18H14N4O2S and a molecular weight of 350.40 g/mol. Its IUPAC name is 6-(4-methoxyphenyl)-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine.
| Compound Name | 6-(4-methoxyphenyl)-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
|---|---|
| PubChem CID | 3163224 |
| Molecular Formula | C18H14N4O2S |
| Molecular Weight | 350.40 g/mol |
| Exact Mass | 350.08 |
| IUPAC Name | 6-(4-methoxyphenyl)-3-methylsulfanyl-[1,2,4]triazino[5,6-d][3,1]benzoxazepine |
| SMILES | COc1ccc(C2=Nc3ccccc3-c3nnc(SC)nc3O2)cc1 |
| InChI | InChI=1S/C18H14N4O2S/c1-23-12-9-7-11(8-10-12)16-19-14-6-4-3-5-13(14)15-17(24-16)20-18(25-2)22-21-15/h3-10H,1-2H3 |
| InChIKey | HZTDZSKFLDPKFA-UHFFFAOYSA-N |
| XLogP | 3.74 |
| TPSA | 69.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.40 |
| LogP ≤ 5 | 3.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'het_thio_67_A(1)', 'substructure': 'N/A'} |
|---|