C15H19N3O3S2 — CID 3163459
3-(benzenesulfonyl)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 3163459) has the molecular formula C15H19N3O3S2 and a molecular weight of 353.47 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 3163459 |
| Molecular Formula | C15H19N3O3S2 |
| Molecular Weight | 353.47 g/mol |
| Exact Mass | 353.09 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(5-tert-butyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CC(C)(C)c1nnc(NC(=O)CCS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C15H19N3O3S2/c1-15(2,3)13-17-18-14(22-13)16-12(19)9-10-23(20,21)11-7-5-4-6-8-11/h4-8H,9-10H2,1-3H3,(H,16,18,19) |
| InChIKey | RMMQDTPJLKPVGD-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.47 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |