C13H15N3O3S2 — CID 6493261
3-(benzenesulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide (PubChem CID 6493261) has the molecular formula C13H15N3O3S2 and a molecular weight of 325.42 g/mol. Its IUPAC name is 3-(benzenesulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide.
| Compound Name | 3-(benzenesulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
|---|---|
| PubChem CID | 6493261 |
| Molecular Formula | C13H15N3O3S2 |
| Molecular Weight | 325.42 g/mol |
| Exact Mass | 325.06 |
| IUPAC Name | 3-(benzenesulfonyl)-N-(5-ethyl-1,3,4-thiadiazol-2-yl)propanamide |
| SMILES | CCc1nnc(NC(=O)CCS(=O)(=O)c2ccccc2)s1 |
| InChI | InChI=1S/C13H15N3O3S2/c1-2-12-15-16-13(20-12)14-11(17)8-9-21(18,19)10-6-4-3-5-7-10/h3-7H,2,8-9H2,1H3,(H,14,16,17) |
| InChIKey | QBEAZGKMDNEXBY-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 89.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.42 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |