C18H19FN4OS — CID 31666225
N-[2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]-3-fluoro-4-methylbenzamide (PubChem CID 31666225) has the molecular formula C18H19FN4OS and a molecular weight of 358.44 g/mol. Its IUPAC name is N-[2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]-3-fluoro-4-methylbenzamide.
| Compound Name | N-[2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]-3-fluoro-4-methylbenzamide |
|---|---|
| PubChem CID | 31666225 |
| Molecular Formula | C18H19FN4OS |
| Molecular Weight | 358.44 g/mol |
| Exact Mass | 358.13 |
| IUPAC Name | N-[2-[(5,6-dimethylthieno[2,3-d]pyrimidin-4-yl)amino]ethyl]-3-fluoro-4-methylbenzamide |
| SMILES | Cc1ccc(C(=O)NCCNc2ncnc3sc(C)c(C)c23)cc1F |
| InChI | InChI=1S/C18H19FN4OS/c1-10-4-5-13(8-14(10)19)17(24)21-7-6-20-16-15-11(2)12(3)25-18(15)23-9-22-16/h4-5,8-9H,6-7H2,1-3H3,(H,21,24)(H,20,22,23) |
| InChIKey | CGNPGFWFUMMXDB-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 66.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 358.44 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|