C26H21N3O3S2 — CID 3167301
ethyl 2-[[2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate (PubChem CID 3167301) has the molecular formula C26H21N3O3S2 and a molecular weight of 487.61 g/mol. Its IUPAC name is ethyl 2-[[2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate.
| Compound Name | ethyl 2-[[2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 3167301 |
| Molecular Formula | C26H21N3O3S2 |
| Molecular Weight | 487.61 g/mol |
| Exact Mass | 487.10 |
| IUPAC Name | ethyl 2-[[2-(3-cyano-6-methylquinolin-2-yl)sulfanylacetyl]amino]-4-phenylthiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccccc2)csc1NC(=O)CSc1nc2ccc(C)cc2cc1C#N |
| InChI | InChI=1S/C26H21N3O3S2/c1-3-32-26(31)23-20(17-7-5-4-6-8-17)14-33-25(23)29-22(30)15-34-24-19(13-27)12-18-11-16(2)9-10-21(18)28-24/h4-12,14H,3,15H2,1-2H3,(H,29,30) |
| InChIKey | OAKZLFGNNXXNQY-UHFFFAOYSA-N |
| XLogP | 6.05 |
| TPSA | 92.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.61 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'} |
|---|