C22H25N3O5 — CID 31679181
[2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 31679181) has the molecular formula C22H25N3O5 and a molecular weight of 411.46 g/mol. Its IUPAC name is [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 31679181 |
| Molecular Formula | C22H25N3O5 |
| Molecular Weight | 411.46 g/mol |
| Exact Mass | 411.18 |
| IUPAC Name | [2-(2-methyl-1H-indol-3-yl)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | Cc1[nH]c2ccccc2c1C(=O)COC(=O)CN1C(=O)N(C)C2(CCCCC2)C1=O |
| InChI | InChI=1S/C22H25N3O5/c1-14-19(15-8-4-5-9-16(15)23-14)17(26)13-30-18(27)12-25-20(28)22(24(2)21(25)29)10-6-3-7-11-22/h4-5,8-9,23H,3,6-7,10-13H2,1-2H3 |
| InChIKey | ISJUCFIRWQFKGT-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 99.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.46 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|