C19H21ClFN3O5 — CID 55367067
[2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 55367067) has the molecular formula C19H21ClFN3O5 and a molecular weight of 425.84 g/mol. Its IUPAC name is [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 55367067 |
| Molecular Formula | C19H21ClFN3O5 |
| Molecular Weight | 425.84 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | [2-(5-chloro-2-fluoroanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CN1C(=O)N(CC(=O)OCC(=O)Nc2cc(Cl)ccc2F)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C19H21ClFN3O5/c1-23-18(28)24(17(27)19(23)7-3-2-4-8-19)10-16(26)29-11-15(25)22-14-9-12(20)5-6-13(14)21/h5-6,9H,2-4,7-8,10-11H2,1H3,(H,22,25) |
| InChIKey | XNBVRTNBGMXAIH-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 96.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.84 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|