C21H24N4O5 — CID 9064513
[2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 9064513) has the molecular formula C21H24N4O5 and a molecular weight of 412.45 g/mol. Its IUPAC name is [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 9064513 |
| Molecular Formula | C21H24N4O5 |
| Molecular Weight | 412.45 g/mol |
| Exact Mass | 412.17 |
| IUPAC Name | [2-[4-(cyanomethyl)anilino]-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CN1C(=O)N(CC(=O)OCC(=O)Nc2ccc(CC#N)cc2)C(=O)C12CCCCC2 |
| InChI | InChI=1S/C21H24N4O5/c1-24-20(29)25(19(28)21(24)10-3-2-4-11-21)13-18(27)30-14-17(26)23-16-7-5-15(6-8-16)9-12-22/h5-8H,2-4,9-11,13-14H2,1H3,(H,23,26) |
| InChIKey | KEMVHRCODHWQFV-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 119.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.45 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|