C21H25N3O6 — CID 31677823
[2-(3-acetylanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate (PubChem CID 31677823) has the molecular formula C21H25N3O6 and a molecular weight of 415.45 g/mol. Its IUPAC name is [2-(3-acetylanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate.
| Compound Name | [2-(3-acetylanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
|---|---|
| PubChem CID | 31677823 |
| Molecular Formula | C21H25N3O6 |
| Molecular Weight | 415.45 g/mol |
| Exact Mass | 415.17 |
| IUPAC Name | [2-(3-acetylanilino)-2-oxoethyl] 2-(1-methyl-2,4-dioxo-1,3-diazaspiro[4.5]decan-3-yl)acetate |
| SMILES | CC(=O)c1cccc(NC(=O)COC(=O)CN2C(=O)N(C)C3(CCCCC3)C2=O)c1 |
| InChI | InChI=1S/C21H25N3O6/c1-14(25)15-7-6-8-16(11-15)22-17(26)13-30-18(27)12-24-19(28)21(23(2)20(24)29)9-4-3-5-10-21/h6-8,11H,3-5,9-10,12-13H2,1-2H3,(H,22,26) |
| InChIKey | OKRIGZZHYXUHJK-UHFFFAOYSA-N |
| XLogP | 1.97 |
| TPSA | 113.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 415.45 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hydantoin', 'substructure': 'N/A'} |
|---|