C28H18ClN5O3S2 — CID 3168167
1-(2-chlorophenothiazin-10-yl)-2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone (PubChem CID 3168167) has the molecular formula C28H18ClN5O3S2 and a molecular weight of 572.07 g/mol. Its IUPAC name is 1-(2-chlorophenothiazin-10-yl)-2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone.
| Compound Name | 1-(2-chlorophenothiazin-10-yl)-2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
|---|---|
| PubChem CID | 3168167 |
| Molecular Formula | C28H18ClN5O3S2 |
| Molecular Weight | 572.07 g/mol |
| Exact Mass | 571.05 |
| IUPAC Name | 1-(2-chlorophenothiazin-10-yl)-2-[[5-(4-nitrophenyl)-4-phenyl-1,2,4-triazol-3-yl]sulfanyl]ethanone |
| SMILES | O=C(CSc1nnc(-c2ccc([N+](=O)[O-])cc2)n1-c1ccccc1)N1c2ccccc2Sc2ccc(Cl)cc21 |
| InChI | InChI=1S/C28H18ClN5O3S2/c29-19-12-15-25-23(16-19)33(22-8-4-5-9-24(22)39-25)26(35)17-38-28-31-30-27(32(28)20-6-2-1-3-7-20)18-10-13-21(14-11-18)34(36)37/h1-16H,17H2 |
| InChIKey | TXALHGWIAPVKHL-UHFFFAOYSA-N |
| XLogP | 7.42 |
| TPSA | 94.16 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.07 |
| LogP ≤ 5 | 7.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|