C20H14FN3O3S2 — CID 31707459
5-(4-fluorophenyl)-2-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one (PubChem CID 31707459) has the molecular formula C20H14FN3O3S2 and a molecular weight of 427.48 g/mol. Its IUPAC name is 5-(4-fluorophenyl)-2-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one.
| Compound Name | 5-(4-fluorophenyl)-2-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 31707459 |
| Molecular Formula | C20H14FN3O3S2 |
| Molecular Weight | 427.48 g/mol |
| Exact Mass | 427.05 |
| IUPAC Name | 5-(4-fluorophenyl)-2-[(1R)-1-(3-nitrophenyl)ethyl]sulfanyl-3H-thieno[2,3-d]pyrimidin-4-one |
| SMILES | C[C@@H](Sc1nc2scc(-c3ccc(F)cc3)c2c(=O)[nH]1)c1cccc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C20H14FN3O3S2/c1-11(13-3-2-4-15(9-13)24(26)27)29-20-22-18(25)17-16(10-28-19(17)23-20)12-5-7-14(21)8-6-12/h2-11H,1H3,(H,22,23,25)/t11-/m1/s1 |
| InChIKey | WLGFVAMABIFERY-LLVKDONJSA-N |
| XLogP | 5.55 |
| TPSA | 88.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.48 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|