C22H17N5O4S2 — CID 6892545
2-[[5-(4-methylphenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide (PubChem CID 6892545) has the molecular formula C22H17N5O4S2 and a molecular weight of 479.54 g/mol. Its IUPAC name is 2-[[5-(4-methylphenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide.
| Compound Name | 2-[[5-(4-methylphenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide |
|---|---|
| PubChem CID | 6892545 |
| Molecular Formula | C22H17N5O4S2 |
| Molecular Weight | 479.54 g/mol |
| Exact Mass | 479.07 |
| IUPAC Name | 2-[[5-(4-methylphenyl)-4-oxo-3H-thieno[2,3-d]pyrimidin-2-yl]sulfanyl]-N-[(E)-(3-nitrophenyl)methylideneamino]acetamide |
| SMILES | Cc1ccc(-c2csc3nc(SCC(=O)N/N=C/c4cccc([N+](=O)[O-])c4)[nH]c(=O)c23)cc1 |
| InChI | InChI=1S/C22H17N5O4S2/c1-13-5-7-15(8-6-13)17-11-32-21-19(17)20(29)24-22(25-21)33-12-18(28)26-23-10-14-3-2-4-16(9-14)27(30)31/h2-11H,12H2,1H3,(H,26,28)(H,24,25,29)/b23-10+ |
| InChIKey | LVDITGRUOMPNAL-AUEPDCJTSA-N |
| XLogP | 4.11 |
| TPSA | 130.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.54 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|