C26H34N6O5 — CID 3174741
N-cyclopentyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide (PubChem CID 3174741) has the molecular formula C26H34N6O5 and a molecular weight of 510.60 g/mol. Its IUPAC name is N-cyclopentyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide.
| Compound Name | N-cyclopentyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 3174741 |
| Molecular Formula | C26H34N6O5 |
| Molecular Weight | 510.60 g/mol |
| Exact Mass | 510.26 |
| IUPAC Name | N-cyclopentyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide |
| SMILES | CCOCCCN(C(=O)Cn1nnc(-c2ccc(OC)cc2)n1)C(C(=O)NC1CCCC1)c1ccco1 |
| InChI | InChI=1S/C26H34N6O5/c1-3-36-16-7-15-31(24(22-10-6-17-37-22)26(34)27-20-8-4-5-9-20)23(33)18-32-29-25(28-30-32)19-11-13-21(35-2)14-12-19/h6,10-14,17,20,24H,3-5,7-9,15-16,18H2,1-2H3,(H,27,34) |
| InChIKey | YCPGORYHOVBFGM-UHFFFAOYSA-N |
| XLogP | 3.00 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 510.60 |
| LogP ≤ 5 | 3.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|