C28H38N6O6 — CID 3174886
N-cyclohexyl-2-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]-(3-ethoxypropyl)amino]-2-(furan-2-yl)acetamide (PubChem CID 3174886) has the molecular formula C28H38N6O6 and a molecular weight of 554.65 g/mol. Its IUPAC name is N-cyclohexyl-2-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]-(3-ethoxypropyl)amino]-2-(furan-2-yl)acetamide.
| Compound Name | N-cyclohexyl-2-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]-(3-ethoxypropyl)amino]-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 3174886 |
| Molecular Formula | C28H38N6O6 |
| Molecular Weight | 554.65 g/mol |
| Exact Mass | 554.29 |
| IUPAC Name | N-cyclohexyl-2-[[2-[5-(3,4-dimethoxyphenyl)tetrazol-2-yl]acetyl]-(3-ethoxypropyl)amino]-2-(furan-2-yl)acetamide |
| SMILES | CCOCCCN(C(=O)Cn1nnc(-c2ccc(OC)c(OC)c2)n1)C(C(=O)NC1CCCCC1)c1ccco1 |
| InChI | InChI=1S/C28H38N6O6/c1-4-39-16-9-15-33(26(23-12-8-17-40-23)28(36)29-21-10-6-5-7-11-21)25(35)19-34-31-27(30-32-34)20-13-14-22(37-2)24(18-20)38-3/h8,12-14,17-18,21,26H,4-7,9-11,15-16,19H2,1-3H3,(H,29,36) |
| InChIKey | AZMYJRUHWOTKEL-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 133.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.65 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|