C27H36N6O5 — CID 40629136
(2S)-N-cyclohexyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide (PubChem CID 40629136) has the molecular formula C27H36N6O5 and a molecular weight of 524.62 g/mol. Its IUPAC name is (2S)-N-cyclohexyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide.
| Compound Name | (2S)-N-cyclohexyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide |
|---|---|
| PubChem CID | 40629136 |
| Molecular Formula | C27H36N6O5 |
| Molecular Weight | 524.62 g/mol |
| Exact Mass | 524.27 |
| IUPAC Name | (2S)-N-cyclohexyl-2-[3-ethoxypropyl-[2-[5-(4-methoxyphenyl)tetrazol-2-yl]acetyl]amino]-2-(furan-2-yl)acetamide |
| SMILES | CCOCCCN(C(=O)Cn1nnc(-c2ccc(OC)cc2)n1)[C@H](C(=O)NC1CCCCC1)c1ccco1 |
| InChI | InChI=1S/C27H36N6O5/c1-3-37-17-8-16-32(25(23-11-7-18-38-23)27(35)28-21-9-5-4-6-10-21)24(34)19-33-30-26(29-31-33)20-12-14-22(36-2)15-13-20/h7,11-15,18,21,25H,3-6,8-10,16-17,19H2,1-2H3,(H,28,35)/t25-/m0/s1 |
| InChIKey | XICXDUJOZAMFLN-VWLOTQADSA-N |
| XLogP | 3.39 |
| TPSA | 124.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.62 |
| LogP ≤ 5 | 3.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|