C23H31N7O — CID 3176600
3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethyl-1H-quinolin-2-one (PubChem CID 3176600) has the molecular formula C23H31N7O and a molecular weight of 421.55 g/mol. Its IUPAC name is 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethyl-1H-quinolin-2-one.
| Compound Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3176600 |
| Molecular Formula | C23H31N7O |
| Molecular Weight | 421.55 g/mol |
| Exact Mass | 421.26 |
| IUPAC Name | 3-[(1-cyclopentyltetrazol-5-yl)-(4-methylpiperazin-1-yl)methyl]-6-ethyl-1H-quinolin-2-one |
| SMILES | CCc1ccc2[nH]c(=O)c(C(c3nnnn3C3CCCC3)N3CCN(C)CC3)cc2c1 |
| InChI | InChI=1S/C23H31N7O/c1-3-16-8-9-20-17(14-16)15-19(23(31)24-20)21(29-12-10-28(2)11-13-29)22-25-26-27-30(22)18-6-4-5-7-18/h8-9,14-15,18,21H,3-7,10-13H2,1-2H3,(H,24,31) |
| InChIKey | LXVTTZXMNRUJQO-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.55 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |