C22H31N6O+ — CID 6970804
[(R)-(1-cyclopentyltetrazol-5-yl)-(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-diethylazanium (PubChem CID 6970804) has the molecular formula C22H31N6O+ and a molecular weight of 395.53 g/mol. Its IUPAC name is [(R)-(1-cyclopentyltetrazol-5-yl)-(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-diethylazanium.
| Compound Name | [(R)-(1-cyclopentyltetrazol-5-yl)-(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-diethylazanium |
|---|---|
| PubChem CID | 6970804 |
| Molecular Formula | C22H31N6O+ |
| Molecular Weight | 395.53 g/mol |
| Exact Mass | 395.26 |
| IUPAC Name | [(R)-(1-cyclopentyltetrazol-5-yl)-(6-ethyl-2-oxo-1H-quinolin-3-yl)methyl]-diethylazanium |
| SMILES | CCc1ccc2[nH]c(=O)c([C@H](c3nnnn3C3CCCC3)[NH+](CC)CC)cc2c1 |
| InChI | InChI=1S/C22H30N6O/c1-4-15-11-12-19-16(13-15)14-18(22(29)23-19)20(27(5-2)6-3)21-24-25-26-28(21)17-9-7-8-10-17/h11-14,17,20H,4-10H2,1-3H3,(H,23,29)/p+1/t20-/m1/s1 |
| InChIKey | BLJFNZSBZWMBPV-HXUWFJFHSA-O |
| XLogP | 2.21 |
| TPSA | 80.90 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.53 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |