C25H33N7O — CID 28606495
3-[(R)-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(1-cyclopentyltetrazol-5-yl)methyl]-6-ethyl-1H-quinolin-2-one (PubChem CID 28606495) has the molecular formula C25H33N7O and a molecular weight of 447.59 g/mol. Its IUPAC name is 3-[(R)-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(1-cyclopentyltetrazol-5-yl)methyl]-6-ethyl-1H-quinolin-2-one.
| Compound Name | 3-[(R)-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(1-cyclopentyltetrazol-5-yl)methyl]-6-ethyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 28606495 |
| Molecular Formula | C25H33N7O |
| Molecular Weight | 447.59 g/mol |
| Exact Mass | 447.27 |
| IUPAC Name | 3-[(R)-[(8aR)-3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl]-(1-cyclopentyltetrazol-5-yl)methyl]-6-ethyl-1H-quinolin-2-one |
| SMILES | CCc1ccc2[nH]c(=O)c([C@H](c3nnnn3C3CCCC3)N3CCN4CCC[C@@H]4C3)cc2c1 |
| InChI | InChI=1S/C25H33N7O/c1-2-17-9-10-22-18(14-17)15-21(25(33)26-22)23(31-13-12-30-11-5-8-20(30)16-31)24-27-28-29-32(24)19-6-3-4-7-19/h9-10,14-15,19-20,23H,2-8,11-13,16H2,1H3,(H,26,33)/t20-,23-/m1/s1 |
| InChIKey | UPMMZHMPCFECTR-NFBKMPQASA-N |
| XLogP | 3.06 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.59 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |