C24H31N7O — CID 3187199
3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one (PubChem CID 3187199) has the molecular formula C24H31N7O and a molecular weight of 433.56 g/mol. Its IUPAC name is 3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one.
| Compound Name | 3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one |
|---|---|
| PubChem CID | 3187199 |
| Molecular Formula | C24H31N7O |
| Molecular Weight | 433.56 g/mol |
| Exact Mass | 433.26 |
| IUPAC Name | 3-[3,4,6,7,8,8a-hexahydro-1H-pyrrolo[1,2-a]pyrazin-2-yl-(1-cyclopentyltetrazol-5-yl)methyl]-7-methyl-1H-quinolin-2-one |
| SMILES | Cc1ccc2cc(C(c3nnnn3C3CCCC3)N3CCN4CCCC4C3)c(=O)[nH]c2c1 |
| InChI | InChI=1S/C24H31N7O/c1-16-8-9-17-14-20(24(32)25-21(17)13-16)22(30-12-11-29-10-4-7-19(29)15-30)23-26-27-28-31(23)18-5-2-3-6-18/h8-9,13-14,18-19,22H,2-7,10-12,15H2,1H3,(H,25,32) |
| InChIKey | RDVJMIQJPVMQAV-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 82.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.56 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |