C17H17F3N2O2 — CID 31773740
N-(2,3-dimethylphenyl)-2-[3-(trifluoromethoxy)anilino]acetamide (PubChem CID 31773740) has the molecular formula C17H17F3N2O2 and a molecular weight of 338.33 g/mol. Its IUPAC name is N-(2,3-dimethylphenyl)-2-[3-(trifluoromethoxy)anilino]acetamide.
| Compound Name | N-(2,3-dimethylphenyl)-2-[3-(trifluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 31773740 |
| Molecular Formula | C17H17F3N2O2 |
| Molecular Weight | 338.33 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | N-(2,3-dimethylphenyl)-2-[3-(trifluoromethoxy)anilino]acetamide |
| SMILES | Cc1cccc(NC(=O)CNc2cccc(OC(F)(F)F)c2)c1C |
| InChI | InChI=1S/C17H17F3N2O2/c1-11-5-3-8-15(12(11)2)22-16(23)10-21-13-6-4-7-14(9-13)24-17(18,19)20/h3-9,21H,10H2,1-2H3,(H,22,23) |
| InChIKey | CDGIYQLMIUBDGA-UHFFFAOYSA-N |
| XLogP | 4.25 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.33 |
| LogP ≤ 5 | 4.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |