C15H12F3IN2O2 — CID 31774679
N-(2-iodophenyl)-2-[3-(trifluoromethoxy)anilino]acetamide (PubChem CID 31774679) has the molecular formula C15H12F3IN2O2 and a molecular weight of 436.17 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-[3-(trifluoromethoxy)anilino]acetamide.
| Compound Name | N-(2-iodophenyl)-2-[3-(trifluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 31774679 |
| Molecular Formula | C15H12F3IN2O2 |
| Molecular Weight | 436.17 g/mol |
| Exact Mass | 435.99 |
| IUPAC Name | N-(2-iodophenyl)-2-[3-(trifluoromethoxy)anilino]acetamide |
| SMILES | O=C(CNc1cccc(OC(F)(F)F)c1)Nc1ccccc1I |
| InChI | InChI=1S/C15H12F3IN2O2/c16-15(17,18)23-11-5-3-4-10(8-11)20-9-14(22)21-13-7-2-1-6-12(13)19/h1-8,20H,9H2,(H,21,22) |
| InChIKey | PIMXZLGEUGGRPJ-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.17 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|