C17H14F3N3O2 — CID 31775100
N-[4-(cyanomethyl)phenyl]-2-[3-(trifluoromethoxy)anilino]acetamide (PubChem CID 31775100) has the molecular formula C17H14F3N3O2 and a molecular weight of 349.31 g/mol. Its IUPAC name is N-[4-(cyanomethyl)phenyl]-2-[3-(trifluoromethoxy)anilino]acetamide.
| Compound Name | N-[4-(cyanomethyl)phenyl]-2-[3-(trifluoromethoxy)anilino]acetamide |
|---|---|
| PubChem CID | 31775100 |
| Molecular Formula | C17H14F3N3O2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 349.10 |
| IUPAC Name | N-[4-(cyanomethyl)phenyl]-2-[3-(trifluoromethoxy)anilino]acetamide |
| SMILES | N#CCc1ccc(NC(=O)CNc2cccc(OC(F)(F)F)c2)cc1 |
| InChI | InChI=1S/C17H14F3N3O2/c18-17(19,20)25-15-3-1-2-14(10-15)22-11-16(24)23-13-6-4-12(5-7-13)8-9-21/h1-7,10,22H,8,11H2,(H,23,24) |
| InChIKey | UPFZKSPYSDVEEO-UHFFFAOYSA-N |
| XLogP | 3.70 |
| TPSA | 74.15 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 3.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |