C22H21ClN2O4S2 — CID 31801318
N-[2-(2-chlorophenoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide (PubChem CID 31801318) has the molecular formula C22H21ClN2O4S2 and a molecular weight of 477.01 g/mol. Its IUPAC name is N-[2-(2-chlorophenoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide.
| Compound Name | N-[2-(2-chlorophenoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
|---|---|
| PubChem CID | 31801318 |
| Molecular Formula | C22H21ClN2O4S2 |
| Molecular Weight | 477.01 g/mol |
| Exact Mass | 476.06 |
| IUPAC Name | N-[2-(2-chlorophenoxy)phenyl]-2-(5-pyrrolidin-1-ylsulfonylthiophen-2-yl)acetamide |
| SMILES | O=C(Cc1ccc(S(=O)(=O)N2CCCC2)s1)Nc1ccccc1Oc1ccccc1Cl |
| InChI | InChI=1S/C22H21ClN2O4S2/c23-17-7-1-3-9-19(17)29-20-10-4-2-8-18(20)24-21(26)15-16-11-12-22(30-16)31(27,28)25-13-5-6-14-25/h1-4,7-12H,5-6,13-15H2,(H,24,26) |
| InChIKey | OGCANQYZECGJDV-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.01 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |