C17H19FN2O4S — CID 31817470
1-(4-fluorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]methanesulfonamide (PubChem CID 31817470) has the molecular formula C17H19FN2O4S and a molecular weight of 366.41 g/mol. Its IUPAC name is 1-(4-fluorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]methanesulfonamide.
| Compound Name | 1-(4-fluorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]methanesulfonamide |
|---|---|
| PubChem CID | 31817470 |
| Molecular Formula | C17H19FN2O4S |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.10 |
| IUPAC Name | 1-(4-fluorophenyl)-N-[1-(furan-3-carbonyl)piperidin-4-yl]methanesulfonamide |
| SMILES | O=C(c1ccoc1)N1CCC(NS(=O)(=O)Cc2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H19FN2O4S/c18-15-3-1-13(2-4-15)12-25(22,23)19-16-5-8-20(9-6-16)17(21)14-7-10-24-11-14/h1-4,7,10-11,16,19H,5-6,8-9,12H2 |
| InChIKey | XGQODQSKRLWFSP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 79.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |