C17H21N3O4 — CID 31838969
methyl 6-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]hexanoate (PubChem CID 31838969) has the molecular formula C17H21N3O4 and a molecular weight of 331.37 g/mol. Its IUPAC name is methyl 6-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]hexanoate.
| Compound Name | methyl 6-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]hexanoate |
|---|---|
| PubChem CID | 31838969 |
| Molecular Formula | C17H21N3O4 |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 331.15 |
| IUPAC Name | methyl 6-[[2-(2-oxoquinoxalin-1-yl)acetyl]amino]hexanoate |
| SMILES | COC(=O)CCCCCNC(=O)Cn1c(=O)cnc2ccccc21 |
| InChI | InChI=1S/C17H21N3O4/c1-24-17(23)9-3-2-6-10-18-15(21)12-20-14-8-5-4-7-13(14)19-11-16(20)22/h4-5,7-8,11H,2-3,6,9-10,12H2,1H3,(H,18,21) |
| InChIKey | YJFUNNPVLQQULC-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 90.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|